C22H22FN3O2S — CID 2561583
2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 2561583) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 2561583 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1C1CCCC1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H22FN3O2S/c23-16-11-9-15(10-12-16)13-24-20(27)14-29-22-25-19-8-4-3-7-18(19)21(28)26(22)17-5-1-2-6-17/h3-4,7-12,17H,1-2,5-6,13-14H2,(H,24,27) |
| InChIKey | VYPCEWBPNUEZPO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |