C22H28N4O3S — CID 35862431
2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N-(cyclopentylcarbamoyl)acetamide (PubChem CID 35862431) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is 2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N-(cyclopentylcarbamoyl)acetamide.
| Compound Name | 2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N-(cyclopentylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 35862431 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N-(cyclopentylcarbamoyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1C1CCCCC1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C22H28N4O3S/c27-19(25-21(29)23-15-8-4-5-9-15)14-30-22-24-18-13-7-6-12-17(18)20(28)26(22)16-10-2-1-3-11-16/h6-7,12-13,15-16H,1-5,8-11,14H2,(H2,23,25,27,29) |
| InChIKey | JPTLQDBOSKOITE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |