C19H23N3O2S — CID 8979979
N-cyclohexyl-2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylacetamide (PubChem CID 8979979) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is N-cyclohexyl-2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-cyclohexyl-2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 8979979 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-cyclohexyl-2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1C1CC1)NC1CCCCC1 |
| InChI | InChI=1S/C19H23N3O2S/c23-17(20-13-6-2-1-3-7-13)12-25-19-21-16-9-5-4-8-15(16)18(24)22(19)14-10-11-14/h4-5,8-9,13-14H,1-3,6-7,10-12H2,(H,20,23) |
| InChIKey | PJSXYIDLYMUGHY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |