C21H28N4O3S — CID 7465795
N-(cyclopentylcarbamoyl)-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 7465795) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-(cyclopentylcarbamoyl)-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(cyclopentylcarbamoyl)-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 7465795 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-(cyclopentylcarbamoyl)-2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | CC(C)CCn1c(SCC(=O)NC(=O)NC2CCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H28N4O3S/c1-14(2)11-12-25-19(27)16-9-5-6-10-17(16)23-21(25)29-13-18(26)24-20(28)22-15-7-3-4-8-15/h5-6,9-10,14-15H,3-4,7-8,11-13H2,1-2H3,(H2,22,24,26,28) |
| InChIKey | MJMXRTHUGGHHKT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |