C21H23N3O2S2 — CID 7628384
2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 7628384) has the molecular formula C21H23N3O2S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 7628384 |
| Molecular Formula | C21H23N3O2S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1C1CCCC1)NCCc1cccs1 |
| InChI | InChI=1S/C21H23N3O2S2/c25-19(22-12-11-16-8-5-13-27-16)14-28-21-23-18-10-4-3-9-17(18)20(26)24(21)15-6-1-2-7-15/h3-5,8-10,13,15H,1-2,6-7,11-12,14H2,(H,22,25) |
| InChIKey | UAVKPVDOMJBMOF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |