C23H21N3O3S2 — CID 17431270
2-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 17431270) has the molecular formula C23H21N3O3S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 2-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 17431270 |
| Molecular Formula | C23H21N3O3S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 2-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | COc1ccccc1-n1c(SCC(=O)NCCc2cccs2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H21N3O3S2/c1-29-20-11-5-4-10-19(20)26-22(28)17-8-2-3-9-18(17)25-23(26)31-15-21(27)24-13-12-16-7-6-14-30-16/h2-11,14H,12-13,15H2,1H3,(H,24,27) |
| InChIKey | AUCIFQKEOJZSFV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |