C22H21N3O2S2 — CID 28574230
2-[1-(4-methoxyphenyl)benzimidazol-2-yl]sulfanyl-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 28574230) has the molecular formula C22H21N3O2S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)benzimidazol-2-yl]sulfanyl-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[1-(4-methoxyphenyl)benzimidazol-2-yl]sulfanyl-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 28574230 |
| Molecular Formula | C22H21N3O2S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)benzimidazol-2-yl]sulfanyl-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | COc1ccc(-n2c(SCC(=O)NCCc3cccs3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C22H21N3O2S2/c1-27-17-10-8-16(9-11-17)25-20-7-3-2-6-19(20)24-22(25)29-15-21(26)23-13-12-18-5-4-14-28-18/h2-11,14H,12-13,15H2,1H3,(H,23,26) |
| InChIKey | CJWOLCBZJAUPTJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |