C25H19N3OS — CID 24622900
2-[4-[(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylmethyl]phenyl]benzonitrile (PubChem CID 24622900) has the molecular formula C25H19N3OS and a molecular weight of 409.51 g/mol. Its IUPAC name is 2-[4-[(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylmethyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylmethyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 24622900 |
| Molecular Formula | C25H19N3OS |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-[4-[(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylmethyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1ccc(CSc2nc3ccccc3c(=O)n2C2CC2)cc1 |
| InChI | InChI=1S/C25H19N3OS/c26-15-19-5-1-2-6-21(19)18-11-9-17(10-12-18)16-30-25-27-23-8-4-3-7-22(23)24(29)28(25)20-13-14-20/h1-12,20H,13-14,16H2 |
| InChIKey | KUTPZLNAGXTCRH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |