C19H15F3N2OS — CID 9381572
3-cyclopropyl-2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one (PubChem CID 9381572) has the molecular formula C19H15F3N2OS and a molecular weight of 376.40 g/mol. Its IUPAC name is 3-cyclopropyl-2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-cyclopropyl-2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 9381572 |
| Molecular Formula | C19H15F3N2OS |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 3-cyclopropyl-2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCc2ccc(C(F)(F)F)cc2)n1C1CC1 |
| InChI | InChI=1S/C19H15F3N2OS/c20-19(21,22)13-7-5-12(6-8-13)11-26-18-23-16-4-2-1-3-15(16)17(25)24(18)14-9-10-14/h1-8,14H,9-11H2 |
| InChIKey | DRIVBUBZIIBJAC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |