C17H14N2O4S — CID 162671537
3-cyclopropyl-2-[(5-hydroxy-4-oxopyran-2-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 162671537) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is 3-cyclopropyl-2-[(5-hydroxy-4-oxopyran-2-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-cyclopropyl-2-[(5-hydroxy-4-oxopyran-2-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 162671537 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 3-cyclopropyl-2-[(5-hydroxy-4-oxopyran-2-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | O=c1cc(CSc2nc3ccccc3c(=O)n2C2CC2)occ1O |
| InChI | InChI=1S/C17H14N2O4S/c20-14-7-11(23-8-15(14)21)9-24-17-18-13-4-2-1-3-12(13)16(22)19(17)10-5-6-10/h1-4,7-8,10,21H,5-6,9H2 |
| InChIKey | VNZMQDRLQUNSGZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |