C16H16N4O3S — CID 8981120
3-cyclopropyl-2-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]sulfanylquinazolin-4-one (PubChem CID 8981120) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is 3-cyclopropyl-2-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-cyclopropyl-2-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 8981120 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3-cyclopropyl-2-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]sulfanylquinazolin-4-one |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1C1CC1)N1CCNC1=O |
| InChI | InChI=1S/C16H16N4O3S/c21-13(19-8-7-17-15(19)23)9-24-16-18-12-4-2-1-3-11(12)14(22)20(16)10-5-6-10/h1-4,10H,5-9H2,(H,17,23) |
| InChIKey | DOSZBPGQCAENGH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |