C22H29N3O2S — CID 42968012
3-cyclohexyl-2-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]sulfanylquinazolin-4-one (PubChem CID 42968012) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 3-cyclohexyl-2-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-cyclohexyl-2-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 42968012 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 3-cyclohexyl-2-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]sulfanylquinazolin-4-one |
| SMILES | CC1CCCN(C(=O)CSc2nc3ccccc3c(=O)n2C2CCCCC2)C1 |
| InChI | InChI=1S/C22H29N3O2S/c1-16-8-7-13-24(14-16)20(26)15-28-22-23-19-12-6-5-11-18(19)21(27)25(22)17-9-3-2-4-10-17/h5-6,11-12,16-17H,2-4,7-10,13-15H2,1H3 |
| InChIKey | JOGPENPJQOTADM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |