C20H26N4O2S — CID 78764352
3-cyclopentyl-2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]sulfanylquinazolin-4-one (PubChem CID 78764352) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 3-cyclopentyl-2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-cyclopentyl-2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 78764352 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 3-cyclopentyl-2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]sulfanylquinazolin-4-one |
| SMILES | CN1CCN(C(=O)CSc2nc3ccccc3c(=O)n2C2CCCC2)CC1 |
| InChI | InChI=1S/C20H26N4O2S/c1-22-10-12-23(13-11-22)18(25)14-27-20-21-17-9-5-4-8-16(17)19(26)24(20)15-6-2-3-7-15/h4-5,8-9,15H,2-3,6-7,10-14H2,1H3 |
| InChIKey | GYJLDUUUOQNQMX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |