C26H30N4O2S — CID 41380703
3-cyclopentyl-2-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylquinazolin-4-one (PubChem CID 41380703) has the molecular formula C26H30N4O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is 3-cyclopentyl-2-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-cyclopentyl-2-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 41380703 |
| Molecular Formula | C26H30N4O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 3-cyclopentyl-2-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylquinazolin-4-one |
| SMILES | Cc1cccc(N2CCN(C(=O)CSc3nc4ccccc4c(=O)n3C3CCCC3)CC2)c1 |
| InChI | InChI=1S/C26H30N4O2S/c1-19-7-6-10-21(17-19)28-13-15-29(16-14-28)24(31)18-33-26-27-23-12-5-4-11-22(23)25(32)30(26)20-8-2-3-9-20/h4-7,10-12,17,20H,2-3,8-9,13-16,18H2,1H3 |
| InChIKey | SNCYKGTUIDCLMG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |