C19H26N6OS — CID 41461433
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone (PubChem CID 41461433) has the molecular formula C19H26N6OS and a molecular weight of 386.53 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 41461433 |
| Molecular Formula | C19H26N6OS |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cccc(N2CCN(C(=O)CSc3nnnn3C3CCCC3)CC2)c1 |
| InChI | InChI=1S/C19H26N6OS/c1-15-5-4-8-17(13-15)23-9-11-24(12-10-23)18(26)14-27-19-20-21-22-25(19)16-6-2-3-7-16/h4-5,8,13,16H,2-3,6-7,9-12,14H2,1H3 |
| InChIKey | LRNFDHORZHHJBJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |