C17H24N6OS2 — CID 9204575
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 9204575) has the molecular formula C17H24N6OS2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 9204575 |
| Molecular Formula | C17H24N6OS2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CSc1nnnn1C1CCCC1)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C17H24N6OS2/c24-16(13-26-17-18-19-20-23(17)14-4-1-2-5-14)22-9-7-21(8-10-22)12-15-6-3-11-25-15/h3,6,11,14H,1-2,4-5,7-10,12-13H2 |
| InChIKey | WAXFWLRBXHXYBJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |