C17H23N5OS2 — CID 41113139
1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylethanone (PubChem CID 41113139) has the molecular formula C17H23N5OS2 and a molecular weight of 377.54 g/mol. Its IUPAC name is 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylethanone.
| Compound Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylethanone |
|---|---|
| PubChem CID | 41113139 |
| Molecular Formula | C17H23N5OS2 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylethanone |
| SMILES | O=C(CSc1nnnn1Cc1cccs1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C17H23N5OS2/c23-16(21-9-3-6-13-5-1-2-8-15(13)21)12-25-17-18-19-20-22(17)11-14-7-4-10-24-14/h4,7,10,13,15H,1-3,5-6,8-9,11-12H2/t13-,15-/m1/s1 |
| InChIKey | SHPIPUQNJOAZMH-UKRRQHHQSA-N |
| XLogP | 3.06 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |