C12H16N4O2S2 — CID 47120873
tert-butyl 2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetate (PubChem CID 47120873) has the molecular formula C12H16N4O2S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is tert-butyl 2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetate.
| Compound Name | tert-butyl 2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 47120873 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | tert-butyl 2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetate |
| SMILES | CC(C)(C)OC(=O)CSc1nnnn1Cc1cccs1 |
| InChI | InChI=1S/C12H16N4O2S2/c1-12(2,3)18-10(17)8-20-11-13-14-15-16(11)7-9-5-4-6-19-9/h4-6H,7-8H2,1-3H3 |
| InChIKey | JJHAFQVQMLYUHD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |