C14H18N6OS2 — CID 51244520
N-(2-cyano-3-methylbutan-2-yl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 51244520) has the molecular formula C14H18N6OS2 and a molecular weight of 350.47 g/mol. Its IUPAC name is N-(2-cyano-3-methylbutan-2-yl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(2-cyano-3-methylbutan-2-yl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 51244520 |
| Molecular Formula | C14H18N6OS2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-(2-cyano-3-methylbutan-2-yl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CC(C)C(C)(C#N)NC(=O)CSc1nnnn1Cc1cccs1 |
| InChI | InChI=1S/C14H18N6OS2/c1-10(2)14(3,9-15)16-12(21)8-23-13-17-18-19-20(13)7-11-5-4-6-22-11/h4-6,10H,7-8H2,1-3H3,(H,16,21) |
| InChIKey | OFOVTWOPTLPPOD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |