C13H22N6OS — CID 46648587
N-(2-cyano-3-methylbutan-2-yl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 46648587) has the molecular formula C13H22N6OS and a molecular weight of 310.43 g/mol. Its IUPAC name is N-(2-cyano-3-methylbutan-2-yl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(2-cyano-3-methylbutan-2-yl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46648587 |
| Molecular Formula | C13H22N6OS |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | N-(2-cyano-3-methylbutan-2-yl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CC(C)Cn1nnnc1SCC(=O)NC(C)(C#N)C(C)C |
| InChI | InChI=1S/C13H22N6OS/c1-9(2)6-19-12(16-17-18-19)21-7-11(20)15-13(5,8-14)10(3)4/h9-10H,6-7H2,1-5H3,(H,15,20) |
| InChIKey | TWTSMDKDPGJFJI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |