C14H16N6OS2 — CID 36987770
N-(1-cyanocyclopentyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 36987770) has the molecular formula C14H16N6OS2 and a molecular weight of 348.46 g/mol. Its IUPAC name is N-(1-cyanocyclopentyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(1-cyanocyclopentyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 36987770 |
| Molecular Formula | C14H16N6OS2 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | N-(1-cyanocyclopentyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | N#CC1(NC(=O)CSc2nnnn2Cc2cccs2)CCCC1 |
| InChI | InChI=1S/C14H16N6OS2/c15-10-14(5-1-2-6-14)16-12(21)9-23-13-17-18-19-20(13)8-11-4-3-7-22-11/h3-4,7H,1-2,5-6,8-9H2,(H,16,21) |
| InChIKey | CODKOJJGLNNXQM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |