C15H13ClN6O2S2 — CID 46639713
4-chloro-N'-[2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]benzohydrazide (PubChem CID 46639713) has the molecular formula C15H13ClN6O2S2 and a molecular weight of 408.90 g/mol. Its IUPAC name is 4-chloro-N'-[2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]benzohydrazide |
|---|---|
| PubChem CID | 46639713 |
| Molecular Formula | C15H13ClN6O2S2 |
| Molecular Weight | 408.90 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 4-chloro-N'-[2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]benzohydrazide |
| SMILES | O=C(CSc1nnnn1Cc1cccs1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13ClN6O2S2/c16-11-5-3-10(4-6-11)14(24)18-17-13(23)9-26-15-19-20-21-22(15)8-12-2-1-7-25-12/h1-7H,8-9H2,(H,17,23)(H,18,24) |
| InChIKey | RQJAVQNWYFQUJL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.90 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|