C16H19ClN6O2S — CID 27047554
4-chloro-N'-[2-(1-cyclohexyltetrazol-5-yl)sulfanylacetyl]benzohydrazide (PubChem CID 27047554) has the molecular formula C16H19ClN6O2S and a molecular weight of 394.89 g/mol. Its IUPAC name is 4-chloro-N'-[2-(1-cyclohexyltetrazol-5-yl)sulfanylacetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-(1-cyclohexyltetrazol-5-yl)sulfanylacetyl]benzohydrazide |
|---|---|
| PubChem CID | 27047554 |
| Molecular Formula | C16H19ClN6O2S |
| Molecular Weight | 394.89 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 4-chloro-N'-[2-(1-cyclohexyltetrazol-5-yl)sulfanylacetyl]benzohydrazide |
| SMILES | O=C(CSc1nnnn1C1CCCCC1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19ClN6O2S/c17-12-8-6-11(7-9-12)15(25)19-18-14(24)10-26-16-20-21-22-23(16)13-4-2-1-3-5-13/h6-9,13H,1-5,10H2,(H,18,24)(H,19,25) |
| InChIKey | ARYVHIMLCPOGAT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.89 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|