C15H17N7O4S — CID 46663645
N'-[2-(1-cyclopentyltetrazol-5-yl)sulfanylacetyl]-4-nitrobenzohydrazide (PubChem CID 46663645) has the molecular formula C15H17N7O4S and a molecular weight of 391.41 g/mol. Its IUPAC name is N'-[2-(1-cyclopentyltetrazol-5-yl)sulfanylacetyl]-4-nitrobenzohydrazide.
| Compound Name | N'-[2-(1-cyclopentyltetrazol-5-yl)sulfanylacetyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 46663645 |
| Molecular Formula | C15H17N7O4S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N'-[2-(1-cyclopentyltetrazol-5-yl)sulfanylacetyl]-4-nitrobenzohydrazide |
| SMILES | O=C(CSc1nnnn1C1CCCC1)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H17N7O4S/c23-13(9-27-15-18-19-20-21(15)11-3-1-2-4-11)16-17-14(24)10-5-7-12(8-6-10)22(25)26/h5-8,11H,1-4,9H2,(H,16,23)(H,17,24) |
| InChIKey | GYCNYSBKGUEIOU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|