C16H20N6O4S — CID 46639292
2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 46639292) has the molecular formula C16H20N6O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 46639292 |
| Molecular Formula | C16H20N6O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nnnn2C2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H20N6O4S/c1-26-12-7-8-13(14(9-12)22(24)25)17-15(23)10-27-16-18-19-20-21(16)11-5-3-2-4-6-11/h7-9,11H,2-6,10H2,1H3,(H,17,23) |
| InChIKey | HFDWSHKZENPNFI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|