C16H21N5O2S — CID 3228988
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 3228988) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 3228988 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)CSc2nnnn2C2CCCC2)cc1 |
| InChI | InChI=1S/C16H21N5O2S/c1-23-14-8-6-12(7-9-14)10-17-15(22)11-24-16-18-19-20-21(16)13-4-2-3-5-13/h6-9,13H,2-5,10-11H2,1H3,(H,17,22) |
| InChIKey | FDFIGUZVVYZMSL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |