C17H23N5O2S — CID 38573156
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[2-(4-methylphenoxy)ethyl]acetamide (PubChem CID 38573156) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[2-(4-methylphenoxy)ethyl]acetamide.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[2-(4-methylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 38573156 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[2-(4-methylphenoxy)ethyl]acetamide |
| SMILES | Cc1ccc(OCCNC(=O)CSc2nnnn2C2CCCC2)cc1 |
| InChI | InChI=1S/C17H23N5O2S/c1-13-6-8-15(9-7-13)24-11-10-18-16(23)12-25-17-19-20-21-22(17)14-4-2-3-5-14/h6-9,14H,2-5,10-12H2,1H3,(H,18,23) |
| InChIKey | IIWHWLRSEZJGNP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|