C14H16ClN5O2S — CID 47037001
N-[2-(3-chlorophenoxy)ethyl]-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide (PubChem CID 47037001) has the molecular formula C14H16ClN5O2S and a molecular weight of 353.84 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)ethyl]-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[2-(3-chlorophenoxy)ethyl]-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 47037001 |
| Molecular Formula | C14H16ClN5O2S |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | N-[2-(3-chlorophenoxy)ethyl]-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1C1CC1)NCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H16ClN5O2S/c15-10-2-1-3-12(8-10)22-7-6-16-13(21)9-23-14-17-18-19-20(14)11-4-5-11/h1-3,8,11H,4-7,9H2,(H,16,21) |
| InChIKey | OVUIDWIKPSJQLZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|