C11H19N5OS — CID 27096193
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(3-methylbutyl)acetamide (PubChem CID 27096193) has the molecular formula C11H19N5OS and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(3-methylbutyl)acetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 27096193 |
| Molecular Formula | C11H19N5OS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(3-methylbutyl)acetamide |
| SMILES | CC(C)CCNC(=O)CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C11H19N5OS/c1-8(2)5-6-12-10(17)7-18-11-13-14-15-16(11)9-3-4-9/h8-9H,3-7H2,1-2H3,(H,12,17) |
| InChIKey | CLKHDISNAFAEBW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |