C10H15N5O4S — CID 106107842
3-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-2-methoxypropanoic acid (PubChem CID 106107842) has the molecular formula C10H15N5O4S and a molecular weight of 301.33 g/mol. Its IUPAC name is 3-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-2-methoxypropanoic acid.
| Compound Name | 3-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 106107842 |
| Molecular Formula | C10H15N5O4S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 3-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-2-methoxypropanoic acid |
| SMILES | COC(CNC(=O)CSc1nnnn1C1CC1)C(=O)O |
| InChI | InChI=1S/C10H15N5O4S/c1-19-7(9(17)18)4-11-8(16)5-20-10-12-13-14-15(10)6-2-3-6/h6-7H,2-5H2,1H3,(H,11,16)(H,17,18) |
| InChIKey | NSUMPZMTVYJXDJ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |