C9H12ClN5OS — CID 115636705
N-(2-chloroprop-2-enyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide (PubChem CID 115636705) has the molecular formula C9H12ClN5OS and a molecular weight of 273.75 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(2-chloroprop-2-enyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 115636705 |
| Molecular Formula | C9H12ClN5OS |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide |
| SMILES | C=C(Cl)CNC(=O)CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C9H12ClN5OS/c1-6(10)4-11-8(16)5-17-9-12-13-14-15(9)7-2-3-7/h7H,1-5H2,(H,11,16) |
| InChIKey | YFWKNYPDGRGYED-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |