C8H12N6O3S — CID 112550936
2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]oxyacetamide (PubChem CID 112550936) has the molecular formula C8H12N6O3S and a molecular weight of 272.29 g/mol. Its IUPAC name is 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]oxyacetamide.
| Compound Name | 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]oxyacetamide |
|---|---|
| PubChem CID | 112550936 |
| Molecular Formula | C8H12N6O3S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]oxyacetamide |
| SMILES | NC(=O)CONC(=O)CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C8H12N6O3S/c9-6(15)3-17-11-7(16)4-18-8-10-12-13-14(8)5-1-2-5/h5H,1-4H2,(H2,9,15)(H,11,16) |
| InChIKey | KARLVVGTLMNSRJ-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|