C9H15N5O2S — CID 43417587
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(3-hydroxypropyl)acetamide (PubChem CID 43417587) has the molecular formula C9H15N5O2S and a molecular weight of 257.32 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(3-hydroxypropyl)acetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 43417587 |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(3-hydroxypropyl)acetamide |
| SMILES | O=C(CSc1nnnn1C1CC1)NCCCO |
| InChI | InChI=1S/C9H15N5O2S/c15-5-1-4-10-8(16)6-17-9-11-12-13-14(9)7-2-3-7/h7,15H,1-6H2,(H,10,16) |
| InChIKey | UJQNHOZEKOYRRE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|