C15H25N5O2S — CID 51287399
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[3-(cyclopropylmethoxy)propyl]acetamide (PubChem CID 51287399) has the molecular formula C15H25N5O2S and a molecular weight of 339.47 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[3-(cyclopropylmethoxy)propyl]acetamide.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[3-(cyclopropylmethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 51287399 |
| Molecular Formula | C15H25N5O2S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[3-(cyclopropylmethoxy)propyl]acetamide |
| SMILES | O=C(CSc1nnnn1C1CCCC1)NCCCOCC1CC1 |
| InChI | InChI=1S/C15H25N5O2S/c21-14(16-8-3-9-22-10-12-6-7-12)11-23-15-17-18-19-20(15)13-4-1-2-5-13/h12-13H,1-11H2,(H,16,21) |
| InChIKey | CGALOUKKRWCDAE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|