C12H19N5OS — CID 51244959
N-cyclohexyl-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide (PubChem CID 51244959) has the molecular formula C12H19N5OS and a molecular weight of 281.38 g/mol. Its IUPAC name is N-cyclohexyl-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-cyclohexyl-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 51244959 |
| Molecular Formula | C12H19N5OS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-cyclohexyl-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1C1CC1)NC1CCCCC1 |
| InChI | InChI=1S/C12H19N5OS/c18-11(13-9-4-2-1-3-5-9)8-19-12-14-15-16-17(12)10-6-7-10/h9-10H,1-8H2,(H,13,18) |
| InChIKey | AOXUAEZMAQYKOV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |