C15H27N5OS — CID 27045923
2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-cyclooctylacetamide (PubChem CID 27045923) has the molecular formula C15H27N5OS and a molecular weight of 325.48 g/mol. Its IUPAC name is 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-cyclooctylacetamide.
| Compound Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-cyclooctylacetamide |
|---|---|
| PubChem CID | 27045923 |
| Molecular Formula | C15H27N5OS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-cyclooctylacetamide |
| SMILES | CC(C)(C)n1nnnc1SCC(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C15H27N5OS/c1-15(2,3)20-14(17-18-19-20)22-11-13(21)16-12-9-7-5-4-6-8-10-12/h12H,4-11H2,1-3H3,(H,16,21) |
| InChIKey | XYSBMPGHEBZKBR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |