C12H23N5OS — CID 40721416
2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[(2R)-3-methylbutan-2-yl]acetamide (PubChem CID 40721416) has the molecular formula C12H23N5OS and a molecular weight of 285.42 g/mol. Its IUPAC name is 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[(2R)-3-methylbutan-2-yl]acetamide.
| Compound Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[(2R)-3-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 40721416 |
| Molecular Formula | C12H23N5OS |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[(2R)-3-methylbutan-2-yl]acetamide |
| SMILES | CC(C)[C@@H](C)NC(=O)CSc1nnnn1C(C)(C)C |
| InChI | InChI=1S/C12H23N5OS/c1-8(2)9(3)13-10(18)7-19-11-14-15-16-17(11)12(4,5)6/h8-9H,7H2,1-6H3,(H,13,18)/t9-/m1/s1 |
| InChIKey | VYXWLIKIGBKVIF-SECBINFHSA-N |
| XLogP | 1.68 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |