C15H22N6OS — CID 51258408
2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 51258408) has the molecular formula C15H22N6OS and a molecular weight of 334.45 g/mol. Its IUPAC name is 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 51258408 |
| Molecular Formula | C15H22N6OS |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CN(C)c1ccc(NC(=O)CSc2nnnn2C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H22N6OS/c1-15(2,3)21-14(17-18-19-21)23-10-13(22)16-11-6-8-12(9-7-11)20(4)5/h6-9H,10H2,1-5H3,(H,16,22) |
| InChIKey | YHKBVXRQFPEZQL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|