C17H26N6OS — CID 9379281
2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[(2R)-2-(dimethylamino)-2-phenylethyl]acetamide (PubChem CID 9379281) has the molecular formula C17H26N6OS and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[(2R)-2-(dimethylamino)-2-phenylethyl]acetamide.
| Compound Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[(2R)-2-(dimethylamino)-2-phenylethyl]acetamide |
|---|---|
| PubChem CID | 9379281 |
| Molecular Formula | C17H26N6OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-[(2R)-2-(dimethylamino)-2-phenylethyl]acetamide |
| SMILES | CN(C)[C@@H](CNC(=O)CSc1nnnn1C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H26N6OS/c1-17(2,3)23-16(19-20-21-23)25-12-15(24)18-11-14(22(4)5)13-9-7-6-8-10-13/h6-10,14H,11-12H2,1-5H3,(H,18,24)/t14-/m0/s1 |
| InChIKey | MKIWKIQSUPMYGO-AWEZNQCLSA-N |
| XLogP | 1.94 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |