C19H22N6OS — CID 42982990
N-[2-(dimethylamino)-2-phenylethyl]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide (PubChem CID 42982990) has the molecular formula C19H22N6OS and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-phenylethyl]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[2-(dimethylamino)-2-phenylethyl]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 42982990 |
| Molecular Formula | C19H22N6OS |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[2-(dimethylamino)-2-phenylethyl]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
| SMILES | CN(C)C(CNC(=O)CSc1nnnn1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N6OS/c1-24(2)17(15-9-5-3-6-10-15)13-20-18(26)14-27-19-21-22-23-25(19)16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3,(H,20,26) |
| InChIKey | BTRGHKLJLJBMDT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |