C17H24N6OS — CID 1440839
2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 1440839) has the molecular formula C17H24N6OS and a molecular weight of 360.49 g/mol. Its IUPAC name is 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 1440839 |
| Molecular Formula | C17H24N6OS |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CN(C)c1ccc(NC(=O)CSc2nnnn2C2CCCCC2)cc1 |
| InChI | InChI=1S/C17H24N6OS/c1-22(2)14-10-8-13(9-11-14)18-16(24)12-25-17-19-20-21-23(17)15-6-4-3-5-7-15/h8-11,15H,3-7,12H2,1-2H3,(H,18,24) |
| InChIKey | VGXWTLSFRLSZBT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|