C19H27N5OS — CID 51258532
2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(2,6-diethylphenyl)acetamide (PubChem CID 51258532) has the molecular formula C19H27N5OS and a molecular weight of 373.53 g/mol. Its IUPAC name is 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 51258532 |
| Molecular Formula | C19H27N5OS |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CSc1nnnn1C1CCCCC1 |
| InChI | InChI=1S/C19H27N5OS/c1-3-14-9-8-10-15(4-2)18(14)20-17(25)13-26-19-21-22-23-24(19)16-11-6-5-7-12-16/h8-10,16H,3-7,11-13H2,1-2H3,(H,20,25) |
| InChIKey | WNBILROXUBMLRZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |