C13H12F3N5OS — CID 26388936
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 26388936) has the molecular formula C13H12F3N5OS and a molecular weight of 343.33 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 26388936 |
| Molecular Formula | C13H12F3N5OS |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1nnnn1C1CC1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H12F3N5OS/c14-13(15,16)8-1-3-9(4-2-8)17-11(22)7-23-12-18-19-20-21(12)10-5-6-10/h1-4,10H,5-7H2,(H,17,22) |
| InChIKey | CECCTCPPXZZOQB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |