C19H19N7O2S — CID 35493846
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[4-(phenylcarbamoylamino)phenyl]acetamide (PubChem CID 35493846) has the molecular formula C19H19N7O2S and a molecular weight of 409.48 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[4-(phenylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[4-(phenylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 35493846 |
| Molecular Formula | C19H19N7O2S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[4-(phenylcarbamoylamino)phenyl]acetamide |
| SMILES | O=C(CSc1nnnn1C1CC1)Nc1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N7O2S/c27-17(12-29-19-23-24-25-26(19)16-10-11-16)20-14-6-8-15(9-7-14)22-18(28)21-13-4-2-1-3-5-13/h1-9,16H,10-12H2,(H,20,27)(H2,21,22,28) |
| InChIKey | KPASKOYXPBRODH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |