C13H16N6OS — CID 43377161
N-(3-amino-4-methylphenyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide (PubChem CID 43377161) has the molecular formula C13H16N6OS and a molecular weight of 304.38 g/mol. Its IUPAC name is N-(3-amino-4-methylphenyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(3-amino-4-methylphenyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 43377161 |
| Molecular Formula | C13H16N6OS |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-(3-amino-4-methylphenyl)-2-(1-cyclopropyltetrazol-5-yl)sulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nnnn2C2CC2)cc1N |
| InChI | InChI=1S/C13H16N6OS/c1-8-2-3-9(6-11(8)14)15-12(20)7-21-13-16-17-18-19(13)10-4-5-10/h2-3,6,10H,4-5,7,14H2,1H3,(H,15,20) |
| InChIKey | RFWSZHCBHMWJAT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|