C13H12F3N5O2S — CID 31813598
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[2-(trifluoromethoxy)phenyl]acetamide (PubChem CID 31813598) has the molecular formula C13H12F3N5O2S and a molecular weight of 359.33 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[2-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[2-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 31813598 |
| Molecular Formula | C13H12F3N5O2S |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[2-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CSc1nnnn1C1CC1)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H12F3N5O2S/c14-13(15,16)23-10-4-2-1-3-9(10)17-11(22)7-24-12-18-19-20-21(12)8-5-6-8/h1-4,8H,5-7H2,(H,17,22) |
| InChIKey | DZQCFJILNSYUNR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |