C17H21N5OS2 — CID 24522799
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-(2-prop-2-enylsulfanylphenyl)acetamide (PubChem CID 24522799) has the molecular formula C17H21N5OS2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-(2-prop-2-enylsulfanylphenyl)acetamide.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-(2-prop-2-enylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 24522799 |
| Molecular Formula | C17H21N5OS2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-(2-prop-2-enylsulfanylphenyl)acetamide |
| SMILES | C=CCSc1ccccc1NC(=O)CSc1nnnn1C1CCCC1 |
| InChI | InChI=1S/C17H21N5OS2/c1-2-11-24-15-10-6-5-9-14(15)18-16(23)12-25-17-19-20-21-22(17)13-7-3-4-8-13/h2,5-6,9-10,13H,1,3-4,7-8,11-12H2,(H,18,23) |
| InChIKey | GKVLTUXFSLYILF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|