C18H19ClN6OS — CID 56536012
N-(4-chloro-2-pyrrol-1-ylphenyl)-2-(1-cyclopentyltetrazol-5-yl)sulfanylacetamide (PubChem CID 56536012) has the molecular formula C18H19ClN6OS and a molecular weight of 402.91 g/mol. Its IUPAC name is N-(4-chloro-2-pyrrol-1-ylphenyl)-2-(1-cyclopentyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(4-chloro-2-pyrrol-1-ylphenyl)-2-(1-cyclopentyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 56536012 |
| Molecular Formula | C18H19ClN6OS |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-(4-chloro-2-pyrrol-1-ylphenyl)-2-(1-cyclopentyltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1C1CCCC1)Nc1ccc(Cl)cc1-n1cccc1 |
| InChI | InChI=1S/C18H19ClN6OS/c19-13-7-8-15(16(11-13)24-9-3-4-10-24)20-17(26)12-27-18-21-22-23-25(18)14-5-1-2-6-14/h3-4,7-11,14H,1-2,5-6,12H2,(H,20,26) |
| InChIKey | PMIRMRFOQLJXJI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |