C15H18ClN5OS — CID 52546923
N-(3-chlorophenyl)-3-(1-cyclopentyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 52546923) has the molecular formula C15H18ClN5OS and a molecular weight of 351.86 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(1-cyclopentyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | N-(3-chlorophenyl)-3-(1-cyclopentyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 52546923 |
| Molecular Formula | C15H18ClN5OS |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-(3-chlorophenyl)-3-(1-cyclopentyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | O=C(CCSc1nnnn1C1CCCC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H18ClN5OS/c16-11-4-3-5-12(10-11)17-14(22)8-9-23-15-18-19-20-21(15)13-6-1-2-7-13/h3-5,10,13H,1-2,6-9H2,(H,17,22) |
| InChIKey | LKIZEGPCKKBDLX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |