C14H17ClN6O — CID 30295842
1-(3-chlorophenyl)-3-[(1-cyclopentyltetrazol-5-yl)methyl]urea (PubChem CID 30295842) has the molecular formula C14H17ClN6O and a molecular weight of 320.78 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(1-cyclopentyltetrazol-5-yl)methyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(1-cyclopentyltetrazol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 30295842 |
| Molecular Formula | C14H17ClN6O |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(1-cyclopentyltetrazol-5-yl)methyl]urea |
| SMILES | O=C(NCc1nnnn1C1CCCC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H17ClN6O/c15-10-4-3-5-11(8-10)17-14(22)16-9-13-18-19-20-21(13)12-6-1-2-7-12/h3-5,8,12H,1-2,6-7,9H2,(H2,16,17,22) |
| InChIKey | BKGYXBUOJUXTJJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |